Octahydropyrrolo[3,4-c]pyrrole - Names and Identifiers
| Name | 3,7-Diazabicyclo[3.3.0]octane
|
| Synonyms | 3,7-Diazabicyclo[3.3.0]octane octahydropyrrolo[3,4-c]pyrrole Octahydropyrrolo[3,4-r]pyrrole hexahydro-pyrrolo[3,4-c]pyrrole Pyrrolo[3,4-c]pyrrole, octahydro- 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole
|
| CAS | 5840-00-6
|
| InChI | InChI=1/C6H12N2/c1-5-2-8-4-6(5)3-7-1/h5-8H,1-4H2 |
Octahydropyrrolo[3,4-c]pyrrole - Physico-chemical Properties
| Molecular Formula | C6H12N2
|
| Molar Mass | 112.17 |
| Density | 0.975 |
| Boling Point | 194 °C |
| Flash Point | 90 °C |
| Vapor Presure | 0.456mmHg at 25°C |
| pKa | 11.23±0.20(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.476 |
Octahydropyrrolo[3,4-c]pyrrole - Introduction
3,7-Diazabicyclo[3.3.0]octane, also known as 3,7-diazabicyclo[3.3.0]octane or simply DABCO, is an organic compound. Its chemical formula is C6H12N2.
Nature:
1. appearance: colorless block crystalline solid.
2. melting point: about 155-157 ℃.
3. Boiling point: about 180 ℃.
4. density: about 1.12 g/cm.
5. Solubility: Soluble in water, alcohol and ether.
Use:
1. Catalyst: DABCO can be used as a catalyst and is widely used in many reactions in organic synthesis, such as oxidation, reduction, hydrogenation, condensation, etc.
2. Ligand: It can be used as a ligand in metal coordination compounds to participate in synergistic chemical reactions.
3. Ion stabilizer and pH regulator: Due to its alkalinity, DABCO can be used as a stabilizer and pH regulator for ionic liquids.
Preparation Method:
DABCO is typically produced by the hydrogenation of ammonia with 2,3-pinane hydrocarbons. A specific synthesis route may be the reaction of 2,3-pinane hydrocarbons with ammonia at high temperature using hydrogen and a platinum catalyst.
Safety Information:
DABCO is a relatively safe compound, but the following points should be noted:
1. cause eye and skin irritation, if contact with eyes or skin, should immediately rinse with plenty of water and seek medical attention.
2. has a stimulating effect on the respiratory system, use should ensure good ventilation.
3. Keep away from fire and high temperature to avoid fire and explosion.
When using DABCO, please follow the safe operating procedures, and evaluate and control risks according to the specific situation.
Last Update:2024-04-10 22:29:15